EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | CC[C@@H](C)CC/C=C/C(C)=C/[C@H](C)CC/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C20H32O2/c1-5-17(2)12-10-11-14-19(4)16-18(3)13-8-6-7-9-15-20(21)22/h6-7,9,11,14-18H,5,8,10,12-13H2,1-4H3,(H,21,22)/b7-6+,14-11+,15-9+,19-16+/t17-,18-/m1/s1 |
| InChIKey | KVMAVNKSYPGPGY-LOFSKYOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17:4(2E,4E,9E,11E)(8Me[R],10Me,15Me[R]) (CHEBI:187938) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4E,8R,9E,11E,15R)-8,10,15-trimethylheptadeca-2,4,9,11-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369097 | ChemSpider |
| LMFA01020381 | LIPID MAPS |