EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O2 |
| Net Charge | 0 |
| Average Mass | 360.582 |
| Monoisotopic Mass | 360.30283 |
| SMILES | O=C(O)CCCCCCCCCCCC1CCC2C(C1)C1C3CCC3C21 |
| InChI | InChI=1S/C24H40O2/c25-22(26)11-9-7-5-3-1-2-4-6-8-10-17-12-13-20-21(16-17)24-19-15-14-18(19)23(20)24/h17-21,23-24H,1-16H2,(H,25,26) |
| InChIKey | CKZGRGZXFFNECL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-[3]-ladderane-dodecanoic acid (CHEBI:187927) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 12-(10-tetracyclo[6.4.0.02,7.03,6]dodecanyl)dodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24822047 | ChemSpider |
| LMFA01140014 | LIPID MAPS |