EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O7 |
| Net Charge | 0 |
| Average Mass | 338.356 |
| Monoisotopic Mass | 338.13655 |
| SMILES | CCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCC)C1c1ccco1 |
| InChI | InChI=1S/C17H22O7/c1-4-22-15(19)12-10(18)9-17(3,21)14(16(20)23-5-2)13(12)11-7-6-8-24-11/h6-8,12-14,21H,4-5,9H2,1-3H3 |
| InChIKey | FDERVCFEOHKBSB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diethyl 2-(2-furyl)-4-hydroxy-4-methyl-6-oxo-1,3-cyclohexanedicarboxylate (CHEBI:187920) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| diethyl 2-(uran-2-yl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 2107567 | ChemSpider |