EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O6 |
| Net Charge | 0 |
| Average Mass | 164.113 |
| Monoisotopic Mass | 164.03209 |
| SMILES | O=C(O)C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C5H8O6/c6-2(4(8)9)1-3(7)5(10)11/h2-3,6-7H,1H2,(H,8,9)(H,10,11) |
| InChIKey | FTWPXBYNGOWCHI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dihydroxy-pentanedioic acid (CHEBI:187913) is a hydroxy carboxylic acid (CHEBI:24669) |
| IUPAC Name |
|---|
| 2,4-dihydroxypentanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 10670471 | ChemSpider |