EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H2N2O6 |
| Net Charge | 0 |
| Average Mass | 186.079 |
| Monoisotopic Mass | 185.99129 |
| SMILES | O=C1NC(=O)N(C(=O)O)C(=O)C1=O |
| InChI | InChI=1S/C5H2N2O6/c8-1-2(9)6-4(11)7(3(1)10)5(12)13/h(H,12,13)(H,6,9,11) |
| InChIKey | ZUOHYBVKWBBXDW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2224) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alloxanoic acid (CHEBI:187908) is a pyrimidinecarboxylic acid (CHEBI:78574) |
| IUPAC Name |
|---|
| 2,4,5,6-tetraoxo-1,3-diazinane-1-carboxylic acid |