EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N2O9S2 |
| Net Charge | -1 |
| Average Mass | 447.467 |
| Monoisotopic Mass | 447.05375 |
| SMILES | O=S(=O)([O-])O/N=C(/Cc1cnc2ccccc12)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20N2O9S2/c19-7-11-13(20)14(21)15(22)16(26-11)28-12(18-27-29(23,24)25)5-8-6-17-10-4-2-1-3-9(8)10/h1-4,6,11,13-17,19-22H,5,7H2,(H,23,24,25)/p-1/b18-12-/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | DNDNWOWHUWNBCK-PIAXYHQTSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-glucobrassicin(1−) (CHEBI:187898) is a indolylmethylglucosinolate (CHEBI:24796) |
| UniProt Name | Source |
|---|---|
| (Z)-glucobrassicin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-1863 | MetaCyc |