EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H37ClO7 |
| Net Charge | 0 |
| Average Mass | 521.050 |
| Monoisotopic Mass | 520.22278 |
| SMILES | CC1=C(C)C(=O)OC(C(C)(O)C2(O)CC=C3C4CC(Cl)C5(O)C(O)C=CC(=O)C5(C)C4CCC32C)C1 |
| InChI | InChI=1S/C28H37ClO7/c1-14-12-22(36-23(32)15(14)2)26(5,33)27(34)11-9-17-16-13-19(29)28(35)21(31)7-6-20(30)25(28,4)18(16)8-10-24(17,27)3/h6-7,9,16,18-19,21-22,31,33-35H,8,10-13H2,1-5H3 |
| InChIKey | BSLUVQZIEQFEOT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Physalolactone C (CHEBI:187847) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| 2-[1-(6-chloro-4,5,17-trihydroxy-10,13-dimethyl-1-oxo-4,6,7,8,9,11,12,16-octahydrocyclopenta[a]phenanthren-17-yl)-1-hydroxyethyl]-4,5-dimethyl-2,3-dihydropyran-6-one |
| Manual Xrefs | Databases |
|---|---|
| 26503909 | ChemSpider |
| HMDB0030142 | HMDB |
| LMST01160014 | LIPID MAPS |