EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29NO4 |
| Net Charge | 0 |
| Average Mass | 299.411 |
| Monoisotopic Mass | 299.20966 |
| SMILES | CCCCCCCCCC(O)CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C16H29NO4/c1-2-3-4-5-6-7-8-9-13(18)12-15(19)17-14-10-11-21-16(14)20/h13-14,18H,2-12H2,1H3,(H,17,19)/t13?,14-/m0/s1 |
| InChIKey | RGTXFFYJJNWEPV-KZUDCZAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-hydroxy-dodecanoyl)-homoserine lactone (CHEBI:187815) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]dodecanamide |
| Manual Xrefs | Databases |
|---|---|
| 9067166 | ChemSpider |
| LMFA08030013 | LIPID MAPS |