EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O5 |
| Net Charge | 0 |
| Average Mass | 450.660 |
| Monoisotopic Mass | 450.33452 |
| SMILES | [H][C@@]12C[C@H](O)C[C@@H](O)[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC[C@@H](C)C(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H46O5/c1-15(6-5-7-16(2)25(31)32)19-8-9-20-24-21(10-11-26(19,20)3)27(4)17(13-22(24)29)12-18(28)14-23(27)30/h15-24,28-30H,5-14H2,1-4H3,(H,31,32)/t15-,16-,17+,18+,19-,20+,21+,22-,23-,24+,26-,27+/m1/s1 |
| InChIKey | JJLSUOWVAMDAIX-NRKUIWSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-1beta,3alpha,7alpha-trihydroxy-5beta-cholestan-26-oic acid (CHEBI:187810) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (2R,6R)-2-methyl-6-[(1R,3S,5S,7R,8S,9S,10S,13R,14S,17R)-1,3,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113385504 | ChemSpider |
| LMST04030188 | LIPID MAPS |