EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17NO4 |
| Net Charge | 0 |
| Average Mass | 287.315 |
| Monoisotopic Mass | 287.11576 |
| SMILES | [H][C@]12Cc3ccc(O)c4c3[C@]3(CCN1)[C@@]2(O)CCC(=O)[C@]3([H])O4 |
| InChI | InChI=1S/C16H17NO4/c18-9-2-1-8-7-11-16(20)4-3-10(19)14-15(16,5-6-17-11)12(8)13(9)21-14/h1-2,11,14,17-18,20H,3-7H2/t11-,14+,15+,16-/m1/s1 |
| InChIKey | HLMSIZPQBSYUNL-IPOQPSJVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Noroxymorphone (CHEBI:187724) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4R,4aS,7aR,12bS)-4a,9-dihydroxy-1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzouro[3,2-e]isoquinolin-7-one |
| Manual Xrefs | Databases |
|---|---|
| 4593755 | ChemSpider |
| HMDB0061073 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:33522-95-1 | ChemIDplus |