EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:187707 - 13-Cyclohexyltridecanoic acid
| Formula | C19H36O2 |
| Net Charge | 0 |
| Average Mass | 296.495 |
| Monoisotopic Mass | 296.27153 |
| SMILES | O=C(O)CCCCCCCCCCCCC1CCCCC1 |
| InChI | InChI=1S/C19H36O2/c20-19(21)17-13-8-6-4-2-1-3-5-7-10-14-18-15-11-9-12-16-18/h18H,1-17H2,(H,20,21) |
| InChIKey | JBTBXKNLITZKLW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-Cyclohexyltridecanoic acid (CHEBI:187707) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 13-cyclohexyltridecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 11553563 | ChemSpider |
| LMFA01140009 | LIPID MAPS |