EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O2 |
| Net Charge | 0 |
| Average Mass | 320.517 |
| Monoisotopic Mass | 320.27153 |
| SMILES | [H][C@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3(C)O)[C@]1([H])[C@H](C)C2 |
| InChI | InChI=1S/C21H36O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h13-18,22-23H,5-12H2,1-4H3/t13-,14+,15-,16+,17+,18-,19+,20+,21+/m1/s1 |
| InChIKey | ZWQUPIDNCOVROC-PNZAEPHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7a,17-dimethyl-5b-Androstane-3a,17b-diol (CHEBI:187701) has role androgen (CHEBI:50113) |
| 7a,17-dimethyl-5b-Androstane-3a,17b-diol (CHEBI:187701) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3R,5S,7R,8R,9S,10S,13S,14S,17S)-7,10,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-3,17-diol |
| Manual Xrefs | Databases |
|---|---|
| LMST02020100 | LIPID MAPS |