EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O3 |
| Net Charge | 0 |
| Average Mass | 308.462 |
| Monoisotopic Mass | 308.23514 |
| SMILES | CCCCc1oc(CCCCCCCCC(=O)O)c(C)c1C |
| InChI | InChI=1S/C19H32O3/c1-4-5-12-17-15(2)16(3)18(22-17)13-10-8-6-7-9-11-14-19(20)21/h4-14H2,1-3H3,(H,20,21) |
| InChIKey | IZEBSZFMLJHHME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-(3,4-dimethyl-5-butylfuran-2-yl)-nonanoic acid (CHEBI:187691) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 9-(5-butyl-3,4-dimethyluran-2-yl)nonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849754 | ChemSpider |
| HMDB0112100 | HMDB |
| LMFA01150022 | LIPID MAPS |