EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O3 |
| Net Charge | 0 |
| Average Mass | 402.619 |
| Monoisotopic Mass | 402.31340 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H](O)CCCC |
| InChI | InChI=1S/C26H42O3/c1-5-6-7-23(28)16(2)19-8-9-20-18-15-24(29)22-14-17(27)10-12-26(22,4)21(18)11-13-25(19,20)3/h16,18-23,28H,5-15H2,1-4H3/t16-,18-,19+,20-,21-,22+,23+,25+,26+/m0/s1 |
| InChIKey | XZSOHMWSWMSLPQ-GPYRGFSRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 27-nor-22R-hydroxy-5alpha-cholestan-3,6-dione (CHEBI:187677) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R)-3-hydroxyheptan-2-yl]-10,13-dimethyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,6-dione |
| Manual Xrefs | Databases |
|---|---|
| 113385043 | ChemSpider |
| LMST01010334 | LIPID MAPS |