EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H56O9 |
| Net Charge | 0 |
| Average Mass | 608.813 |
| Monoisotopic Mass | 608.39243 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC(=O)[C@]4(C)[C@@H](CC)[C@@H](O[C@@]5(C)CC[C@@H](C)CO5)C[C@@]34[H])[C@@]1(C)CC[C@H](O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O)C2 |
| InChI | InChI=1S/C34H56O9/c1-6-22-25(43-33(4)12-9-18(2)17-40-33)14-24-21-8-7-19-13-20(41-31-30(39)29(38)28(37)26(16-35)42-31)10-11-32(19,3)23(21)15-27(36)34(22,24)5/h18-26,28-31,35,37-39H,6-17H2,1-5H3/t18-,19+,20+,21-,22+,23+,24+,25+,26?,28+,29+,30?,31-,32+,33+,34-/m1/s1 |
| InChIKey | WLKLMRNAKWFHRC-BKAIPPKLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-(Galb)-(25R)-12-oxo-5alpha-spirostan-3beta-ol (CHEBI:187621) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| (3S,5S,8R,9S,10S,13S,14S,16S,17R)-16-[(2S,5R)-2,5-dimethyloxan-2-yl]oxy-17-ethyl-10,13-dimethyl-3-[(2R,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-one |
| Manual Xrefs | Databases |
|---|---|
| LMST01080077 | LIPID MAPS |