EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H33FO6 |
| Net Charge | 0 |
| Average Mass | 544.619 |
| Monoisotopic Mass | 544.22612 |
| SMILES | CCCc1c(OCCCOc2cc(O)c(-c3ccc(F)cc3)cc2CC)cccc1Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C33H33FO6/c1-3-9-25-29(12-7-13-30(25)40-31-11-6-5-10-26(31)33(36)37)38-18-8-19-39-32-21-28(35)27(20-22(32)4-2)23-14-16-24(34)17-15-23/h5-7,10-17,20-21,35H,3-4,8-9,18-19H2,1-2H3,(H,36,37) |
| InChIKey | YFIZRWPXUYFCSN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LY293111 (CHEBI:187612) has role antineoplastic agent (CHEBI:35610) |
| LY293111 (CHEBI:187612) is a aromatic ether (CHEBI:35618) |
| IUPAC Name |
|---|
| 2-[3-[3-[2-ethyl-4-(4-luorophenyl)-5-hydroxyphenoxy]propoxy]-2-propylphenoxy]benzoic acid |
| INN | Source |
|---|---|
| etalocib | WHO MedNet |
| Synonyms | Source |
|---|---|
| etalocib | ChEMBL |
| LY-193111 | ChEMBL |
| LY-293111 | ChEMBL |
| LY293111 | ChEMBL |
| VML 295 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:161172-51-6 | ChemIDplus |
| Citations |
|---|