EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O4 |
| Net Charge | 0 |
| Average Mass | 326.477 |
| Monoisotopic Mass | 326.24571 |
| SMILES | CCCCCC1OC1C(/C=C/CCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C19H34O4/c1-3-4-10-14-17-19(23-17)16(22-2)13-11-8-6-5-7-9-12-15-18(20)21/h11,13,16-17,19H,3-10,12,14-15H2,1-2H3,(H,20,21)/b13-11+ |
| InChIKey | WLOMJJRDPWCKSV-ACCUITESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-methoxy-12,13-epoxy-9-octadecenoic acid (CHEBI:187473) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-11-methoxy-11-(3-pentyloxiran-2-yl)undec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4446154 | ChemSpider |
| LMFA01080007 | LIPID MAPS |