EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29ClO3 |
| Net Charge | 0 |
| Average Mass | 328.880 |
| Monoisotopic Mass | 328.18052 |
| SMILES | [H][C@@]1([C@@H](Cl)CC)C[C@@H]2O[C@@H]2[C@H]1/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H29ClO3/c1-2-15(19)14-12-16-18(22-16)13(14)10-8-6-4-3-5-7-9-11-17(20)21/h8,10,13-16,18H,2-7,9,11-12H2,1H3,(H,20,21)/b10-8-/t13-,14+,15-,16-,18+/m0/s1 |
| InChIKey | HKOGBNDXDHPYJT-RLHIQTTISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Egregiachloride B (CHEBI:187441) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (Z)-10-[(1R,2S,3R,5S)-3-[(1S)-1-chloropropyl]-6-oxabicyclo[3.1.0]hexan-2-yl]dec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03120053 | LIPID MAPS |
| 113369769 | ChemSpider |