EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18O2 |
| Net Charge | 0 |
| Average Mass | 242.318 |
| Monoisotopic Mass | 242.13068 |
| SMILES | C/C=C/C#CC#C/C=C/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C16H18O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-3,8-11H,12-15H2,1H3,(H,17,18)/b3-2+,9-8+,11-10+ |
| InChIKey | QRMUVFBZROTBPM-MMOYHAHMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6E,8E,14E-Hexadecatriene-10,12-diynoic acid (CHEBI:187414) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (6E,8E,14E)-hexadeca-6,8,14-trien-10,12-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822563 | ChemSpider |
| LMFA01030704 | LIPID MAPS |