EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N3O2 |
| Net Charge | 0 |
| Average Mass | 391.515 |
| Monoisotopic Mass | 391.22598 |
| SMILES | O=C(/C=C/c1cccnc1)NCCCCC1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O2/c28-23(12-11-21-8-6-15-25-19-21)26-16-5-4-7-20-13-17-27(18-14-20)24(29)22-9-2-1-3-10-22/h1-3,6,8-12,15,19-20H,4-5,7,13-14,16-18H2,(H,26,28)/b12-11+ |
| InChIKey | KPBNHDGDUADAGP-VAWYXSNFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FK-866 (CHEBI:187413) has role antineoplastic agent (CHEBI:35610) |
| FK-866 (CHEBI:187413) is a N-acylpiperidine (CHEBI:48591) |
| FK-866 (CHEBI:187413) is a benzamides (CHEBI:22702) |
| IUPAC Name |
|---|
| (E)-N-[4-(1-benzoylpiperidin-4-yl)butyl]-3-pyridin-3-ylprop-2-enamide |
| INN | Source |
|---|---|
| daporinad | WHO MedNet |
| Synonyms | Source |
|---|---|
| APO 866 | ChEMBL |
| APO-866 | ChEMBL |
| APO866 | ChEMBL |
| daporinad | ChEMBL |
| FK 866 | ChEMBL |
| FK-866 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:201034-75-5 | ChemIDplus |
| Citations |
|---|