EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H35AsO3 |
| Net Charge | 0 |
| Average Mass | 374.397 |
| Monoisotopic Mass | 374.18022 |
| SMILES | C[As](C)(=O)CCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H35AsO3/c1-19(2,22)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(20)21/h3,5H,4,6-17H2,1-2H3,(H,20,21)/b5-3- |
| InChIKey | FZOQEVBDCNSQIJ-HYXAFXHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-dimethylarsinoyl-9Z-hexadecenoic acid (CHEBI:187398) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (Z)-16-dimethylarsorylhexadec-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368130 | ChemSpider |
| LMFA00000032 | LIPID MAPS |