EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | O=C(O)CCC#CC#C/C=C/CO |
| InChI | InChI=1S/C10H10O3/c11-9-7-5-3-1-2-4-6-8-10(12)13/h5,7,11H,6,8-9H2,(H,12,13)/b7-5+ |
| InChIKey | JIPUTTVWDAXSEZ-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxy-8E-Decene-4,6-diynoic acid (CHEBI:187365) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-10-hydroxydec-8-en-4,6-diynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 7822571 | ChemSpider |
| LMFA01030712 | LIPID MAPS |