EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O3 |
| Net Charge | 0 |
| Average Mass | 346.511 |
| Monoisotopic Mass | 346.25079 |
| SMILES | CCCCCCCCC#CC#CC1OC1CCCCCCCC(=O)O |
| InChI | InChI=1S/C22H34O3/c1-2-3-4-5-6-7-8-9-11-14-17-20-21(25-20)18-15-12-10-13-16-19-22(23)24/h20-21H,2-8,10,12-13,15-16,18-19H2,1H3,(H,23,24) |
| InChIKey | RRAFKGMABGTGAF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,10-epoxy-11,13-docosadiynoic acid (CHEBI:187321) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 8-(3-dodeca-1,3-diynyloxiran-2-yl)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368317 | ChemSpider |
| LMFA01070037 | LIPID MAPS |