EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19O3P |
| Net Charge | 0 |
| Average Mass | 302.310 |
| Monoisotopic Mass | 302.10718 |
| SMILES | O=C(O)CCCCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19O3P/c18-17(19)13-7-8-14-21(20,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2,(H,18,19) |
| InChIKey | KIGXMYYGQYMICF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Diphenylphosphine Acid (CHEBI:187316) is a phosphine (CHEBI:35883) |
| IUPAC Name |
|---|
| 5-diphenylphosphorylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8555615 | ChemSpider |