EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25NO9S2 |
| Net Charge | 0 |
| Average Mass | 403.475 |
| Monoisotopic Mass | 403.09707 |
| SMILES | CCC(C)CC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C13H25NO9S2/c1-3-7(2)4-5-9(14-23-25(19,20)21)24-13-12(18)11(17)10(16)8(6-15)22-13/h7-8,10-13,15-18H,3-6H2,1-2H3,(H,19,20,21)/b14-9+ |
| InChIKey | ISQHSPNQOCVWOY-NTEUORMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Methylpentyl glucosinolate (CHEBI:187253) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-4-methyl-N-sulooxyhexanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014122 | ChemSpider |
| HMDB0036355 | HMDB |