EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H46O4 |
| Net Charge | 0 |
| Average Mass | 398.628 |
| Monoisotopic Mass | 398.33961 |
| SMILES | CCCCCCCCCCCC(O)CC(O)/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C24H46O4/c1-2-3-4-5-6-7-9-12-15-18-22(25)21-23(26)19-16-13-10-8-11-14-17-20-24(27)28/h16,19,22-23,25-26H,2-15,17-18,20-21H2,1H3,(H,27,28)/b19-16+ |
| InChIKey | AKVZFALHMAASOY-KNTRCKAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Axillarenic acid (CHEBI:187234) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (E)-11,13-dihydroxytetracos-9-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368276 | ChemSpider |
| LMFA01050418 | LIPID MAPS |