EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H65NO4 |
| Net Charge | 0 |
| Average Mass | 539.886 |
| Monoisotopic Mass | 539.49136 |
| SMILES | CC(C)CCCCCCCCCCCO[C@H](CCCCCCCCCCCC(C)C)CC(=O)NCC(=O)O |
| InChI | InChI=1S/C33H65NO4/c1-29(2)23-19-15-11-7-5-9-13-17-21-25-31(27-32(35)34-28-33(36)37)38-26-22-18-14-10-6-8-12-16-20-24-30(3)4/h29-31H,5-28H2,1-4H3,(H,34,35)(H,36,37)/t31-/m1/s1 |
| InChIKey | PRINJPAYVNUVQA-WJOKGBTCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(15-methyl-3-(12-methyl-tridecanoyloxy)-hexadecanoyl)-glycine (CHEBI:187233) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(3R)-15-methyl-3-(12-methyltridecoxy)hexadecanoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 113371142 | ChemSpider |
| LMFA08040059 | LIPID MAPS |