EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41NO4 |
| Net Charge | 0 |
| Average Mass | 383.573 |
| Monoisotopic Mass | 383.30356 |
| SMILES | CCCCCCCCCCCCCCCC(O)CC(=O)N[C@H]1CCOC1=O |
| InChI | InChI=1S/C22H41NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(24)18-21(25)23-20-16-17-27-22(20)26/h19-20,24H,2-18H2,1H3,(H,23,25)/t19?,20-/m0/s1 |
| InChIKey | IHJILWQXHBSFMS-ANYOKISRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-hydroxy-octadecanoyl)-homoserine lactone (CHEBI:187212) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 3-hydroxy-N-[(3S)-2-oxooxolan-3-yl]octadecanamide |
| Manual Xrefs | Databases |
|---|---|
| 113371167 | ChemSpider |
| LMFA08030011 | LIPID MAPS |