EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O |
| Net Charge | 0 |
| Average Mass | 282.427 |
| Monoisotopic Mass | 282.19837 |
| SMILES | CC1=C(/C=C/C(C)=C2/C=C/C(=C/C=O)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H26O/c1-15(18-9-8-17(14-18)11-13-21)7-10-19-16(2)6-5-12-20(19,3)4/h7-11,13H,5-6,12,14H2,1-4H3/b10-7+,17-11-,18-15- |
| InChIKey | PHPBVFJVLKEZBG-DTOWMSEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-cis- and 12s-trans-fixed retinal (CHEBI:187164) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2E)-2-[(4E)-4-[(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-ylidene]cyclopent-2-en-1-ylidene]acetaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 17220991 | ChemSpider |
| LMPR01090040 | LIPID MAPS |