EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H50O2 |
| Net Charge | 0 |
| Average Mass | 382.673 |
| Monoisotopic Mass | 382.38108 |
| SMILES | CCCCCCCCCCCCCCCCCCC[C@H](C)C[C@H](C)C(=O)O |
| InChI | InChI=1S/C25H50O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(2)22-24(3)25(26)27/h23-24H,4-22H2,1-3H3,(H,26,27)/t23-,24-/m0/s1 |
| InChIKey | ZLKBEACXHMFBSH-ZEQRLZLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mycosanoic acid (C25) (CHEBI:187155) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (2S,4S)-2,4-dimethyltricosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113369047 | ChemSpider |
| LMFA01020294 | LIPID MAPS |