EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO4 |
| Net Charge | 0 |
| Average Mass | 297.395 |
| Monoisotopic Mass | 297.19401 |
| SMILES | CCCCCC/C=C/C=C(\CCCCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C16H27NO4/c1-2-3-4-5-6-7-9-12-15(17(20)21)13-10-8-11-14-16(18)19/h7,9,12H,2-6,8,10-11,13-14H2,1H3,(H,18,19)/b9-7+,15-12+ |
| InChIKey | LQLPBMSWEIRISV-KDFHGORWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dinor-7-NO2-CLA (CHEBI:187079) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (7E,9E)-7-nitrohexadeca-7,9-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368357 | ChemSpider |
| LMFA01120007 | LIPID MAPS |