EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:187033 - 9,9-dimethoxy-nonanoic acid
| Formula | C11H22O4 |
| Net Charge | 0 |
| Average Mass | 218.293 |
| Monoisotopic Mass | 218.15181 |
| SMILES | COC(CCCCCCCC(=O)O)OC |
| InChI | InChI=1S/C11H22O4/c1-14-11(15-2)9-7-5-3-4-6-8-10(12)13/h11H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | XDIISQHQFQMEIB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,9-dimethoxy-nonanoic acid (CHEBI:187033) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 9,9-dimethoxynonanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01080019 | LIPID MAPS |
| 9195542 | ChemSpider |