EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H52NO12P |
| Net Charge | 0 |
| Average Mass | 637.704 |
| Monoisotopic Mass | 637.32271 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCC(=O)O |
| InChI | InChI=1S/C29H52NO12P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-27(33)39-21-24(42-28(34)20-17-18-26(31)32)22-40-43(37,38)41-23-25(30)29(35)36/h9-10,24-25H,2-8,11-23,30H2,1H3,(H,31,32)(H,35,36)(H,37,38)/b10-9-/t24-,25+/m1/s1 |
| InChIKey | IZVJSAQUVWOMJB-MVKCUJKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OG-PS (CHEBI:187014) is a phosphatidyl-L-serine (CHEBI:18303) |
| IUPAC Name |
|---|
| 5-[(2R)-1-[[(2S)-2-amino-2-carboxyethoxy]-hydroxyphosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl]oxy-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113380899 | ChemSpider |
| LMGP20040021 | LIPID MAPS |