EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26Cl2O2 |
| Net Charge | 0 |
| Average Mass | 297.266 |
| Monoisotopic Mass | 296.13099 |
| SMILES | CCCCCCCCC(Cl)C(Cl)CCCC(=O)O |
| InChI | InChI=1S/C14H26Cl2O2/c1-2-3-4-5-6-7-9-12(15)13(16)10-8-11-14(17)18/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | MBWXQZXGUAFIDF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,6-dichloro-tetradecanoic acid (CHEBI:187007) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 5,6-dichlorotetradecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 21376576 | ChemSpider |
| LMFA01090061 | LIPID MAPS |