EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O3 |
| Net Charge | 0 |
| Average Mass | 364.570 |
| Monoisotopic Mass | 364.29775 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCO)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C23H40O3/c1-14(9-11-24)18-6-7-19-17-5-4-15-12-16(25)8-10-22(15,2)20(17)13-21(26)23(18,19)3/h14-21,24-26H,4-13H2,1-3H3/t14-,15-,16-,17+,18-,19+,20+,21+,22+,23-/m1/s1 |
| InChIKey | JWKNPWJGFZVWMB-XQNRYLPDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-Nor-5beta-cholane-3alpha,12alpha,23-triol (CHEBI:186974) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3R,5R,8R,9S,10S,12S,13R,14S,17R)-17-[(2R)-4-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| Manual Xrefs | Databases |
|---|---|
| 4447394 | ChemSpider |
| LMST04060011 | LIPID MAPS |