EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O4 |
| Net Charge | 0 |
| Average Mass | 436.677 |
| Monoisotopic Mass | 436.35526 |
| SMILES | [H][C@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@@]([H])([C@H](C)CCCC(C)CO)[C@H](O)C[C@@]3([H])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O4/c1-16(15-28)6-5-7-17(2)25-23(31)14-21-24-20(9-11-27(21,25)4)26(3)10-8-19(29)12-18(26)13-22(24)30/h16-25,28-31H,5-15H2,1-4H3/t16?,17-,18-,19-,20+,21+,22-,23-,24-,25+,26+,27+/m1/s1 |
| InChIKey | NHNHDZACHWAKJW-PMBIVPNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5alpha-Cholestane-3alpha,7alpha,16alpha,26-tetrol (CHEBI:186969) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3R,5R,7R,8R,9S,10S,13S,14S,16R,17R)-17-[(2R)-7-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,16-triol |
| Manual Xrefs | Databases |
|---|---|
| LMST04030002 | LIPID MAPS |
| 4447270 | ChemSpider |