EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20NO4 |
| Net Charge | +1 |
| Average Mass | 266.317 |
| Monoisotopic Mass | 266.13868 |
| SMILES | C[N+](C)(C)CCOC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H19NO4/c1-15(2,3)8-9-19-14(18)7-5-11-4-6-12(16)13(17)10-11/h4-7,10H,8-9H2,1-3H3,(H-,16,17,18)/p+1 |
| InChIKey | HLGBXKIGYXVIFU-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-{[3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}ethyl)trimethylazanium (CHEBI:186964) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 2-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]ethyl-trimethylazanium |
| Manual Xrefs | Databases |
|---|---|
| 4945043 | ChemSpider |
| HMDB0136312 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:87189-10-4 | ChemIDplus |