EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O8 |
| Net Charge | 0 |
| Average Mass | 424.490 |
| Monoisotopic Mass | 424.20972 |
| SMILES | CC/C=C\C/C=C\C/C=C/C=C/C1CC(C2CC(C(CCC(=O)O)OO)OO2)OO1 |
| InChI | InChI=1S/C22H32O8/c1-2-3-4-5-6-7-8-9-10-11-12-17-15-19(28-27-17)21-16-20(29-30-21)18(26-25)13-14-22(23)24/h3-4,6-7,9-12,17-21,25H,2,5,8,13-16H2,1H3,(H,23,24)/b4-3-,7-6-,10-9+,12-11+ |
| InChIKey | KTKHEQUWMNHXRH-OOWSTOOWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(5'-((1E,3E,6Z,9Z)-dodeca-1,3,6,9-tetraen-1-yl)-[3,3'-bi(1,2-dioxolan)]-5-yl)-4-hydroperoxybutanoic acid (CHEBI:186932) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| IUPAC Name |
|---|
| 4-[5-[5-[(1E,3E,6Z,9Z)-dodeca-1,3,6,9-tetraenyl]dioxolan-3-yl]dioxolan-3-yl]-4-hydroperoxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113386102 | ChemSpider |
| LMFA04060002 | LIPID MAPS |