EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C27H46O2/c28-27(29)25-21-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-18-22-26-23-19-17-20-24-26/h17,19-20,23-24H,1-16,18,21-22,25H2,(H,28,29) |
| InChIKey | NTNZDKQMAVVRKI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 21-phenyl heneicosanoic acid (CHEBI:186930) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| 21-phenylhenicosanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01140071 | LIPID MAPS |
| 113368377 | ChemSpider |