EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38O7 |
| Net Charge | 0 |
| Average Mass | 486.605 |
| Monoisotopic Mass | 486.26175 |
| SMILES | [H][C@]12C[C@H](O)[C@@]3(C)[C@@]([H])([C@H](O)C[C@]3([H])[C@H](C)C3CC(C)=C(C)C(=O)O3)[C@]1([H])[C@@H]1O[C@@H]1[C@@]1(O)CC=CC(=O)[C@]21C |
| InChI | InChI=1S/C28H38O7/c1-12-9-18(34-25(32)13(12)2)14(3)15-10-17(29)22-21-16(11-20(31)26(15,22)4)27(5)19(30)7-6-8-28(27,33)24-23(21)35-24/h6-7,14-18,20-24,29,31,33H,8-11H2,1-5H3/t14-,15+,16-,17+,18?,20-,21+,22-,23-,24-,26-,27-,28-/m0/s1 |
| InChIKey | PXNLYJYFBSKVBN-UBDVXSTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15beta-Hydroxynicandrin B (CHEBI:186927) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (1R,2S,4S,5R,10R,11S,13S,14R,15R,17R,18S)-15-[(1S)-1-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)ethyl]-5,13,17-trihydroxy-10,14-dimethyl-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-7-en-9-one |
| Manual Xrefs | Databases |
|---|---|
| LMST01160001 | LIPID MAPS |