EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:186907 - 2,6-Piperidinedicarboxylic acid
| Formula | C7H11NO4 |
| Net Charge | 0 |
| Average Mass | 173.168 |
| Monoisotopic Mass | 173.06881 |
| SMILES | O=C(O)C1CCCC(C(=O)O)N1 |
| InChI | InChI=1S/C7H11NO4/c9-6(10)4-2-1-3-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12) |
| InChIKey | SOOPBZRXJMNXTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-Piperidinedicarboxylic acid (CHEBI:186907) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| piperidine-2,6-dicarboxylic acid |