EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H35NO4 |
| Net Charge | 0 |
| Average Mass | 377.525 |
| Monoisotopic Mass | 377.25661 |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C22H35NO4/c1-2-3-4-5-10-13-16-20(24)17-14-11-8-6-7-9-12-15-18-21(25)23-19-22(26)27/h7-11,13-14,17,20,24H,2-6,12,15-16,18-19H2,1H3,(H,23,25)(H,26,27)/b9-7-,11-8-,13-10-,17-14+/t20-/m0/s1 |
| InChIKey | IEDOAPXQRUEANC-DJNHXDDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-HETE-Gly (CHEBI:186903) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 113371124 | ChemSpider |
| LMFA08020144 | LIPID MAPS |