EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O2 |
| Net Charge | 0 |
| Average Mass | 398.631 |
| Monoisotopic Mass | 398.31848 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC(=O)C(=C)C |
| InChI | InChI=1S/C27H42O2/c1-17(2)25(29)11-6-18(3)22-9-10-23-21-8-7-19-16-20(28)12-14-26(19,4)24(21)13-15-27(22,23)5/h7,18,20-24,28H,1,6,8-16H2,2-5H3/t18-,20+,21+,22-,23+,24+,26+,27-/m1/s1 |
| InChIKey | AHQSISRIGWKDQV-ZHHJOTBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-keto-25dehydrocholesterol (CHEBI:186882) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-1-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| 27025191 | ChemSpider |
| LMST01010299 | LIPID MAPS |