EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40N2O3 |
| Net Charge | 0 |
| Average Mass | 356.551 |
| Monoisotopic Mass | 356.30389 |
| SMILES | CCCCCCCCCCCCCC(=O)NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C20H40N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-16-19(23)22-17-14-13-15-18(21)20(24)25/h18H,2-17,21H2,1H3,(H,22,23)(H,24,25)/t18-/m0/s1 |
| InChIKey | XTLFOGNEQSPWGW-SFHVURJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-myristoyl lysine (CHEBI:186865) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-(tetradecanoylamino)hexanoic acid |
| Registry Numbers | Sources |
|---|---|
| CAS:62471-07-2 | ChemIDplus |