EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18O5 |
| Net Charge | 0 |
| Average Mass | 266.293 |
| Monoisotopic Mass | 266.11542 |
| SMILES | CC1(C)OC1Cc1cc(CC(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H18O5/c1-14(2)12(19-14)7-9-5-8(3-4-10(9)15)6-11(16)13(17)18/h3-5,11-12,15-16H,6-7H2,1-2H3,(H,17,18) |
| InChIKey | LMTXUJRDHMJNMY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-{3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl}-2-hydroxypropanoic acid (CHEBI:186864) is a benzenes (CHEBI:22712) |
| 3-{3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl}-2-hydroxypropanoic acid (CHEBI:186864) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 3-[3-[(3,3-dimethyloxiran-2-yl)methyl]-4-hydroxyphenyl]-2-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74853219 | ChemSpider |
| HMDB0133197 | HMDB |