EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H6O4 |
| Net Charge | 0 |
| Average Mass | 190.154 |
| Monoisotopic Mass | 190.02661 |
| SMILES | O=C(O)C#CC#CC#CCCC(=O)O |
| InChI | InChI=1S/C10H6O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h5,7H2,(H,11,12)(H,13,14) |
| InChIKey | AXNJDXRYHHYANB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Deca-2,4,6-triynedioic acid (CHEBI:186827) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| deca-2,4,6-triynedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 60745187 | ChemSpider |
| LMFA01031138 | LIPID MAPS |