EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO11 |
| Net Charge | 0 |
| Average Mass | 457.432 |
| Monoisotopic Mass | 457.15841 |
| SMILES | [H][C@@]1(OC[C@H]2O[C@@H](O[C@@H](C#N)c3ccccc3)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11+,12+,13+,14+,15-,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | XUCIJNAGGSZNQT-JHSLDZJXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Prunus armeniaca (ncbitaxon:36596) | kernel (BTO:0000668) | PubMed (10670815) | |
| Prunus domestica (ncbitaxon:3758) | kernel (BTO:0000668) | PubMed (12232058) | |
| Prunus dulcis var. amara (ncbitaxon:3756) | kernel (BTO:0000668) | PubMed (7092570) | |
| Prunus persica (ncbitaxon:3760) | kernel (BTO:0000668) | PubMed (7092570) | |
| Prunus serotina (ncbitaxon:23207) | kernel (BTO:0000668) | PubMed (16652960) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-amygdalin (CHEBI:17019) has functional parent (R)-mandelonitrile (CHEBI:18450) |
| (R)-amygdalin (CHEBI:17019) has role antineoplastic agent (CHEBI:35610) |
| (R)-amygdalin (CHEBI:17019) has role apoptosis inducer (CHEBI:68495) |
| (R)-amygdalin (CHEBI:17019) has role plant metabolite (CHEBI:76924) |
| (R)-amygdalin (CHEBI:17019) is a amygdalin (CHEBI:27613) |
| IUPAC Name |
|---|
| (2R)-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy](phenyl)acetonitrile |
| Synonyms | Source |
|---|---|
| (-)-D-mandelonitrile beta-D-gentiobioside | ChEBI |
| (R)-Amygdalin | KEGG COMPOUND |
| (R)-Amygdaloside | KEGG COMPOUND |
| (R)-Laenitrile | KEGG COMPOUND |
| D-amygdalin | ChemIDplus |
| D-(−)-mandelonitrile-β-D-gentiobioside | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-amygdalin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Amygdalin | Wikipedia |
| C00001437 | KNApSAcK |
| C08325 | KEGG COMPOUND |
| CPD-1125 | MetaCyc |
| HMDB0035030 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:66856 | Reaxys |
| CAS:29883-15-6 | ChemIDplus |
| Citations |
|---|