EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO |
| Net Charge | 0 |
| Average Mass | 133.150 |
| Monoisotopic Mass | 133.05276 |
| SMILES | N#C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H/t8-/m0/s1 |
| InChIKey | NNICRUQPODTGRU-QMMMGPOBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-mandelonitrile (CHEBI:18450) is a mandelonitrile (CHEBI:16910) |
| (R)-mandelonitrile (CHEBI:18450) is enantiomer of (S)-mandelonitrile (CHEBI:36941) |
| Incoming Relation(s) |
| (R)-amygdalin (CHEBI:17019) has functional parent (R)-mandelonitrile (CHEBI:18450) |
| lucumin (CHEBI:6559) has functional parent (R)-mandelonitrile (CHEBI:18450) |
| (S)-mandelonitrile (CHEBI:36941) is enantiomer of (R)-mandelonitrile (CHEBI:18450) |
| IUPAC Name |
|---|
| (2R)-hydroxy(phenyl)acetonitrile |
| Synonyms | Source |
|---|---|
| d-mandelonitrile | ChEBI |
| (R)-(+)-mandelonitrile | ChEBI |
| (+)-mandelonitrile | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-mandelonitrile | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2613369 | Beilstein |
| Beilstein:3588636 | Beilstein |
| Beilstein:3588637 | Beilstein |