EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23NO4 |
| Net Charge | 0 |
| Average Mass | 269.341 |
| Monoisotopic Mass | 269.16271 |
| SMILES | CCCCCC/C=C/C=C(\CCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C14H23NO4/c1-2-3-4-5-6-7-8-10-13(15(18)19)11-9-12-14(16)17/h7-8,10H,2-6,9,11-12H2,1H3,(H,16,17)/b8-7+,13-10+ |
| InChIKey | WBHKJNXCKZWPFQ-AWGJLQHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | feces (BTO:0000440) | MetaboLights (MTBLS3750) | Strain: C57BL/6 Mouse [NCIT:C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tetranor-5-NO2-CLA (CHEBI:186801) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (5E,7E)-5-nitrotetradeca-5,7-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 113368360 | ChemSpider |
| LMFA01120010 | LIPID MAPS |