EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:1868 - 4-Hydroxyhydratropate
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CC(C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O3/c1-6(9(11)12)7-2-4-8(10)5-3-7/h2-6,10H,1H3,(H,11,12) |
| InChIKey | ZHMMPVANGNPCBW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood (UBERON:0000178) | PubMed (19812218) | ||
| urine (BTO:0001419) | PubMed (19812218) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxyhydratropate (CHEBI:1868) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| 2-(4-hydroxyphenyl)propanoic acid | HMDB |
| 4-Hydroxyhydratropate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03080 | KEGG COMPOUND |
| HMDB0041683 | HMDB |
| Citations |
|---|